C14H13NOS — CID 145358217
[1]benzofuro[3,2-c]pyridine-8-thiol;prop-1-ene (PubChem CID 145358217) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is [1]benzofuro[3,2-c]pyridine-8-thiol;prop-1-ene.
| Compound Name | [1]benzofuro[3,2-c]pyridine-8-thiol;prop-1-ene |
|---|---|
| PubChem CID | 145358217 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | [1]benzofuro[3,2-c]pyridine-8-thiol;prop-1-ene |
| SMILES | C=CC.Sc1ccc2oc3ccncc3c2c1 |
| InChI | InChI=1S/C11H7NOS.C3H6/c14-7-1-2-10-8(5-7)9-6-12-4-3-11(9)13-10;1-3-2/h1-6,14H;3H,1H2,2H3 |
| InChIKey | XJGSLYTZFSNLAM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|