About 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine
7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine (PubChem CID 159117597) has the molecular formula C19H17N2O+
and a molecular weight of 289.36 g/mol. Its IUPAC name is 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine.
Molecular Properties
| Compound Name | 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine |
| PubChem CID | 159117597 |
| Molecular Formula | C19H17N2O+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine |
| SMILES | Cc1ccc(-c2cc3oc4ccncc4c3cc2C)[n+](C)c1 |
| InChI | InChI=1S/C19H17N2O/c1-12-4-5-17(21(3)11-12)14-9-19-15(8-13(14)2)16-10-20-7-6-18(16)22-19/h4-11H,1-3H3/q+1 |
| InChIKey | GUEYZZSINFPLIB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine?
The IUPAC name of 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine (CID 159117597) is 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine.
What is the SMILES notation for 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine?
The canonical SMILES for 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine is Cc1ccc(-c2cc3oc4ccncc4c3cc2C)[n+](C)c1.
What is the InChIKey of 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine?
The InChIKey is GUEYZZSINFPLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N2O/c1-12-4-5-17(21(3)11-12)14-9-19-15(8-13(14)2)16-10-20-7-6-18(16)22-19/h4-11H,1-3H3/q+1.
What are the key properties of 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine?
7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine has a molecular weight of 289.36 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,5-dimethylpyridin-1-ium-2-yl)-8-methyl-[1]benzofuro[3,2-c]pyridine is sourced from PubChem (CID 159117597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).