C22H23N2O+ — CID 158630499
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine (PubChem CID 158630499) has the molecular formula C22H23N2O+ and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine.
| Compound Name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 158630499 |
| Molecular Formula | C22H23N2O+ |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-[1]benzofuro[3,2-c]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc3oc4ccnc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c4c3cc2C)[n+](C)c1 |
| InChI | InChI=1S/C22H23N2O/c1-13(2)22-21-17-10-15(4)16(18-7-6-14(3)12-24(18)5)11-20(17)25-19(21)8-9-23-22/h6-13H,1-5H3/q+1/i1D3,2D3,3D3,13D |
| InChIKey | GBVROAKAWIQTMX-PUIBTECMSA-N |
| XLogP | 5.21 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|