About 2-furo[3,2-c]pyridin-2-ylacetonitrile
2-furo[3,2-c]pyridin-2-ylacetonitrile (PubChem CID 14948605) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-furo[3,2-c]pyridin-2-ylacetonitrile.
Molecular Properties
| Compound Name | 2-furo[3,2-c]pyridin-2-ylacetonitrile |
| PubChem CID | 14948605 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-furo[3,2-c]pyridin-2-ylacetonitrile |
| SMILES | N#CCc1cc2cnccc2o1 |
| InChI | InChI=1S/C9H6N2O/c10-3-1-8-5-7-6-11-4-2-9(7)12-8/h2,4-6H,1H2 |
| InChIKey | CBLLZJFCQXXOHU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-furo[3,2-c]pyridin-2-ylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-furo[3,2-c]pyridin-2-ylacetonitrile?
The IUPAC name of 2-furo[3,2-c]pyridin-2-ylacetonitrile (CID 14948605) is 2-furo[3,2-c]pyridin-2-ylacetonitrile.
What is the SMILES notation for 2-furo[3,2-c]pyridin-2-ylacetonitrile?
The canonical SMILES for 2-furo[3,2-c]pyridin-2-ylacetonitrile is N#CCc1cc2cnccc2o1.
What is the InChIKey of 2-furo[3,2-c]pyridin-2-ylacetonitrile?
The InChIKey is CBLLZJFCQXXOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c10-3-1-8-5-7-6-11-4-2-9(7)12-8/h2,4-6H,1H2.
What are the key properties of 2-furo[3,2-c]pyridin-2-ylacetonitrile?
2-furo[3,2-c]pyridin-2-ylacetonitrile has a molecular weight of 158.16 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-furo[3,2-c]pyridin-2-ylacetonitrile is sourced from PubChem (CID 14948605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).