C18H24N2O4 — CID 141186127
4-[4-(furo[3,2-c]pyridin-2-ylmethoxy)butyl]piperidine-1-carboxylic acid (PubChem CID 141186127) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[4-(furo[3,2-c]pyridin-2-ylmethoxy)butyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-(furo[3,2-c]pyridin-2-ylmethoxy)butyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141186127 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[4-(furo[3,2-c]pyridin-2-ylmethoxy)butyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(CCCCOCc2cc3cnccc3o2)CC1 |
| InChI | InChI=1S/C18H24N2O4/c21-18(22)20-8-5-14(6-9-20)3-1-2-10-23-13-16-11-15-12-19-7-4-17(15)24-16/h4,7,11-12,14H,1-3,5-6,8-10,13H2,(H,21,22) |
| InChIKey | IHZSZVRYDBBNCQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|