C18H22N2O4S — CID 11494262
tert-butyl 4-(furo[3,2-c]pyridine-2-carbonylsulfanyl)piperidine-1-carboxylate (PubChem CID 11494262) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is tert-butyl 4-(furo[3,2-c]pyridine-2-carbonylsulfanyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(furo[3,2-c]pyridine-2-carbonylsulfanyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11494262 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | tert-butyl 4-(furo[3,2-c]pyridine-2-carbonylsulfanyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(SC(=O)c2cc3cnccc3o2)CC1 |
| InChI | InChI=1S/C18H22N2O4S/c1-18(2,3)24-17(22)20-8-5-13(6-9-20)25-16(21)15-10-12-11-19-7-4-14(12)23-15/h4,7,10-11,13H,5-6,8-9H2,1-3H3 |
| InChIKey | LOSLTIOAAZYMPU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|