C16H20N2O3 — CID 19597717
tert-butyl 2-furo[3,2-c]pyridin-2-ylpyrrolidine-1-carboxylate (PubChem CID 19597717) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl 2-furo[3,2-c]pyridin-2-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-furo[3,2-c]pyridin-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19597717 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl 2-furo[3,2-c]pyridin-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1cc2cnccc2o1 |
| InChI | InChI=1S/C16H20N2O3/c1-16(2,3)21-15(19)18-8-4-5-12(18)14-9-11-10-17-7-6-13(11)20-14/h6-7,9-10,12H,4-5,8H2,1-3H3 |
| InChIKey | DGHPDSLKALXJPY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |