C25H26N4O3S — CID 90381466
N-[4-[1-(furo[2,3-c]pyridine-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 90381466) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[4-[1-(furo[2,3-c]pyridine-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(furo[2,3-c]pyridine-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90381466 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[4-[1-(furo[2,3-c]pyridine-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2cc3ccncc3o2)CC1)c1cc2ccncc2s1 |
| InChI | InChI=1S/C25H26N4O3S/c30-24(22-14-19-5-10-27-16-23(19)33-22)28-8-2-1-3-17-6-11-29(12-7-17)25(31)20-13-18-4-9-26-15-21(18)32-20/h4-5,9-10,13-17H,1-3,6-8,11-12H2,(H,28,30) |
| InChIKey | CVROTXHJJMTMMV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|