C27H28N2O2S2 — CID 158197684
6-[1-(1-benzothiophene-2-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one (PubChem CID 158197684) has the molecular formula C27H28N2O2S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 6-[1-(1-benzothiophene-2-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one.
| Compound Name | 6-[1-(1-benzothiophene-2-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one |
|---|---|
| PubChem CID | 158197684 |
| Molecular Formula | C27H28N2O2S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 6-[1-(1-benzothiophene-2-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one |
| SMILES | O=C(CCCCCC1CCN(C(=O)c2cc3ccccc3s2)CC1)c1cc2ccncc2s1 |
| InChI | InChI=1S/C27H28N2O2S2/c30-22(24-16-21-10-13-28-18-26(21)33-24)8-3-1-2-6-19-11-14-29(15-12-19)27(31)25-17-20-7-4-5-9-23(20)32-25/h4-5,7,9-10,13,16-19H,1-3,6,8,11-12,14-15H2 |
| InChIKey | GANQOGWBXVGYIG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|