C21H21N3O2S — CID 55601176
1-(1-benzothiophene-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 55601176) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-(1-benzothiophene-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-benzothiophene-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55601176 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-(1-benzothiophene-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCN(C(=O)c2cc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H21N3O2S/c25-20(23-14-15-4-3-9-22-13-15)16-7-10-24(11-8-16)21(26)19-12-17-5-1-2-6-18(17)27-19/h1-6,9,12-13,16H,7-8,10-11,14H2,(H,23,25) |
| InChIKey | KMJWUILBHNKUSX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |