C19H18Cl3N3O3 — CID 112821228
N-(pyridin-3-ylmethyl)-1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidine-4-carboxamide (PubChem CID 112821228) has the molecular formula C19H18Cl3N3O3 and a molecular weight of 442.73 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(pyridin-3-ylmethyl)-1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112821228 |
| Molecular Formula | C19H18Cl3N3O3 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCN(C(=O)c2c(O)c(Cl)cc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C19H18Cl3N3O3/c20-13-8-14(21)17(26)15(16(13)22)19(28)25-6-3-12(4-7-25)18(27)24-10-11-2-1-5-23-9-11/h1-2,5,8-9,12,26H,3-4,6-7,10H2,(H,24,27) |
| InChIKey | ALLRWBPKFIOPGQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|