C24H26ClN3O2S — CID 70983195
N-[4-[1-(4-chlorobenzoyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 70983195) has the molecular formula C24H26ClN3O2S and a molecular weight of 456.01 g/mol. Its IUPAC name is N-[4-[1-(4-chlorobenzoyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(4-chlorobenzoyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70983195 |
| Molecular Formula | C24H26ClN3O2S |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-[4-[1-(4-chlorobenzoyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2ccc(Cl)cc2)CC1)c1cc2ccncc2s1 |
| InChI | InChI=1S/C24H26ClN3O2S/c25-20-6-4-18(5-7-20)24(30)28-13-9-17(10-14-28)3-1-2-11-27-23(29)21-15-19-8-12-26-16-22(19)31-21/h4-8,12,15-17H,1-3,9-11,13-14H2,(H,27,29) |
| InChIKey | NJZHXCNPCGKZKP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|