C24H28Cl2N4O2 — CID 129142653
N-[4-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]butyl]-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 129142653) has the molecular formula C24H28Cl2N4O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is N-[4-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]butyl]-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]butyl]-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129142653 |
| Molecular Formula | C24H28Cl2N4O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[4-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]butyl]-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1)C1Cc2cnccc2N1 |
| InChI | InChI=1S/C24H28Cl2N4O2/c25-19-11-17(12-20(26)14-19)24(32)30-9-5-16(6-10-30)3-1-2-7-28-23(31)22-13-18-15-27-8-4-21(18)29-22/h4,8,11-12,14-16,22,29H,1-3,5-7,9-10,13H2,(H,28,31) |
| InChIKey | SAEKQMFHHIYUIM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|