C24H27ClN4O2 — CID 163599313
N-[4-[1-(3-chlorobenzoyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 163599313) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is N-[4-[1-(3-chlorobenzoyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(3-chlorobenzoyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163599313 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[4-[1-(3-chlorobenzoyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)c2cccc(Cl)c2)CC1)C1C=c2cnccc2=N1 |
| InChI | InChI=1S/C24H27ClN4O2/c25-20-6-3-5-18(14-20)24(31)29-12-8-17(9-13-29)4-1-2-10-27-23(30)22-15-19-16-26-11-7-21(19)28-22/h3,5-7,11,14-17,22H,1-2,4,8-10,12-13H2,(H,27,30) |
| InChIKey | GWFVHLAGWCPHQT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|