C25H24Cl2N4O2S — CID 139919074
N-[3-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]propyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide (PubChem CID 139919074) has the molecular formula C25H24Cl2N4O2S and a molecular weight of 515.47 g/mol. Its IUPAC name is N-[3-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]propyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide.
| Compound Name | N-[3-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]propyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 139919074 |
| Molecular Formula | C25H24Cl2N4O2S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | N-[3-[1-(3,5-dichlorobenzoyl)piperidin-4-yl]propyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
| SMILES | O=C(NCCCC1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1)C1=Cc2cnc3cccc(n23)S1 |
| InChI | InChI=1S/C25H24Cl2N4O2S/c26-18-11-17(12-19(27)13-18)25(33)30-9-6-16(7-10-30)3-2-8-28-24(32)21-14-20-15-29-22-4-1-5-23(34-21)31(20)22/h1,4-5,11-16H,2-3,6-10H2,(H,28,32) |
| InChIKey | IZSRCDBNIWLLNU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|