C24H23ClN4O3S — CID 10116850
N-[2-[1-(4-chlorobenzoyl)piperidin-4-yl]oxyethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide (PubChem CID 10116850) has the molecular formula C24H23ClN4O3S and a molecular weight of 482.99 g/mol. Its IUPAC name is N-[2-[1-(4-chlorobenzoyl)piperidin-4-yl]oxyethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide.
| Compound Name | N-[2-[1-(4-chlorobenzoyl)piperidin-4-yl]oxyethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 10116850 |
| Molecular Formula | C24H23ClN4O3S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-[2-[1-(4-chlorobenzoyl)piperidin-4-yl]oxyethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
| SMILES | O=C(NCCOC1CCN(C(=O)c2ccc(Cl)cc2)CC1)C1=Cc2cnc3cccc(n23)S1 |
| InChI | InChI=1S/C24H23ClN4O3S/c25-17-6-4-16(5-7-17)24(31)28-11-8-19(9-12-28)32-13-10-26-23(30)20-14-18-15-27-21-2-1-3-22(33-20)29(18)21/h1-7,14-15,19H,8-13H2,(H,26,30) |
| InChIKey | LLKBRQBJMSMCBP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|