C16H18Cl2N4OS — CID 70246993
N-[2-(2,5-dihydro-1H-pyrrol-3-yl)ethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride (PubChem CID 70246993) has the molecular formula C16H18Cl2N4OS and a molecular weight of 385.32 g/mol. Its IUPAC name is N-[2-(2,5-dihydro-1H-pyrrol-3-yl)ethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride.
| Compound Name | N-[2-(2,5-dihydro-1H-pyrrol-3-yl)ethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70246993 |
| Molecular Formula | C16H18Cl2N4OS |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | N-[2-(2,5-dihydro-1H-pyrrol-3-yl)ethyl]-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCC1=CCNC1)C1=Cc2cnc3cccc(n23)S1 |
| InChI | InChI=1S/C16H16N4OS.2ClH/c21-16(18-7-5-11-4-6-17-9-11)13-8-12-10-19-14-2-1-3-15(22-13)20(12)14;;/h1-4,8,10,17H,5-7,9H2,(H,18,21);2*1H |
| InChIKey | ICQZRISJXLPHCK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|