C17H22Cl2N4OS2 — CID 139919124
N-(2-piperidin-4-ylsulfanylethyl)-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride (PubChem CID 139919124) has the molecular formula C17H22Cl2N4OS2 and a molecular weight of 433.43 g/mol. Its IUPAC name is N-(2-piperidin-4-ylsulfanylethyl)-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride.
| Compound Name | N-(2-piperidin-4-ylsulfanylethyl)-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 139919124 |
| Molecular Formula | C17H22Cl2N4OS2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-(2-piperidin-4-ylsulfanylethyl)-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCSC1CCNCC1)C1=Cc2cnc3cccc(n23)S1 |
| InChI | InChI=1S/C17H20N4OS2.2ClH/c22-17(19-8-9-23-13-4-6-18-7-5-13)14-10-12-11-20-15-2-1-3-16(24-14)21(12)15;;/h1-3,10-11,13,18H,4-9H2,(H,19,22);2*1H |
| InChIKey | NVWZTCCFAGAHPP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|