C20H31N5O2 — CID 168813877
1-pyridin-4-yl-3-[5-[1-(pyrrolidine-2-carbonyl)pyrrolidin-3-yl]pentyl]urea (PubChem CID 168813877) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-pyridin-4-yl-3-[5-[1-(pyrrolidine-2-carbonyl)pyrrolidin-3-yl]pentyl]urea.
| Compound Name | 1-pyridin-4-yl-3-[5-[1-(pyrrolidine-2-carbonyl)pyrrolidin-3-yl]pentyl]urea |
|---|---|
| PubChem CID | 168813877 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-pyridin-4-yl-3-[5-[1-(pyrrolidine-2-carbonyl)pyrrolidin-3-yl]pentyl]urea |
| SMILES | O=C(NCCCCCC1CCN(C(=O)C2CCCN2)C1)Nc1ccncc1 |
| InChI | InChI=1S/C20H31N5O2/c26-19(18-6-4-11-22-18)25-14-9-16(15-25)5-2-1-3-10-23-20(27)24-17-7-12-21-13-8-17/h7-8,12-13,16,18,22H,1-6,9-11,14-15H2,(H2,21,23,24,27) |
| InChIKey | XEXLPJSAWXWNFC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|