C27H38N4O2S — CID 140651867
N-[4-[1-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 140651867) has the molecular formula C27H38N4O2S and a molecular weight of 482.69 g/mol. Its IUPAC name is N-[4-[1-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140651867 |
| Molecular Formula | C27H38N4O2S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[4-[1-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CN1C(C(=O)N2CCC(CCCCNC(=O)c3cc4ccncc4s3)CC2)CC2CCCCC21 |
| InChI | InChI=1S/C27H38N4O2S/c1-30-22-8-3-2-7-20(22)16-23(30)27(33)31-14-10-19(11-15-31)6-4-5-12-29-26(32)24-17-21-9-13-28-18-25(21)34-24/h9,13,17-20,22-23H,2-8,10-12,14-16H2,1H3,(H,29,32) |
| InChIKey | SWMWMMSXKCKGME-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|