C24H34N4O3S — CID 129142612
N-[4-[1-(4-propan-2-yl-1,3-oxazolidine-5-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 129142612) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is N-[4-[1-(4-propan-2-yl-1,3-oxazolidine-5-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(4-propan-2-yl-1,3-oxazolidine-5-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129142612 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-[4-[1-(4-propan-2-yl-1,3-oxazolidine-5-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CC(C)C1NCOC1C(=O)N1CCC(CCCCNC(=O)c2cc3ccncc3s2)CC1 |
| InChI | InChI=1S/C24H34N4O3S/c1-16(2)21-22(31-15-27-21)24(30)28-11-7-17(8-12-28)5-3-4-9-26-23(29)19-13-18-6-10-25-14-20(18)32-19/h6,10,13-14,16-17,21-22,27H,3-5,7-9,11-12,15H2,1-2H3,(H,26,29) |
| InChIKey | NNQICALCJVMBJG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|