C25H32F3N3O2S — CID 140651901
N-[4-[1-[4-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 140651901) has the molecular formula C25H32F3N3O2S and a molecular weight of 495.61 g/mol. Its IUPAC name is N-[4-[1-[4-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-[4-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140651901 |
| Molecular Formula | C25H32F3N3O2S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-[4-[1-[4-(trifluoromethyl)cyclohexanecarbonyl]piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)C2CCC(C(F)(F)F)CC2)CC1)c1cc2ccncc2s1 |
| InChI | InChI=1S/C25H32F3N3O2S/c26-25(27,28)20-6-4-18(5-7-20)24(33)31-13-9-17(10-14-31)3-1-2-11-30-23(32)21-15-19-8-12-29-16-22(19)34-21/h8,12,15-18,20H,1-7,9-11,13-14H2,(H,30,32) |
| InChIKey | QWDHZMPTLYQXIX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|