C25H34FN3O2S — CID 140651970
N-[4-[1-(3-fluoro-4-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 140651970) has the molecular formula C25H34FN3O2S and a molecular weight of 459.63 g/mol. Its IUPAC name is N-[4-[1-(3-fluoro-4-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(3-fluoro-4-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140651970 |
| Molecular Formula | C25H34FN3O2S |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[4-[1-(3-fluoro-4-methylcyclohexanecarbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CC1CCC(C(=O)N2CCC(CCCCNC(=O)c3cc4ccncc4s3)CC2)CC1F |
| InChI | InChI=1S/C25H34FN3O2S/c1-17-5-6-20(14-21(17)26)25(31)29-12-8-18(9-13-29)4-2-3-10-28-24(30)22-15-19-7-11-27-16-23(19)32-22/h7,11,15-18,20-21H,2-6,8-10,12-14H2,1H3,(H,28,30) |
| InChIKey | LMLHVNSDILWIQF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|