C27H28N4O2S2 — CID 147985860
6-[1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one (PubChem CID 147985860) has the molecular formula C27H28N4O2S2 and a molecular weight of 504.68 g/mol. Its IUPAC name is 6-[1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one.
| Compound Name | 6-[1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one |
|---|---|
| PubChem CID | 147985860 |
| Molecular Formula | C27H28N4O2S2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 6-[1-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-thieno[2,3-c]pyridin-2-ylhexan-1-one |
| SMILES | O=C(CCCCCC1CCN(C(=O)c2csc(-c3cccnc3)n2)CC1)c1cc2ccncc2s1 |
| InChI | InChI=1S/C27H28N4O2S2/c32-23(24-15-20-8-12-29-17-25(20)35-24)7-3-1-2-5-19-9-13-31(14-10-19)27(33)22-18-34-26(30-22)21-6-4-11-28-16-21/h4,6,8,11-12,15-19H,1-3,5,7,9-10,13-14H2 |
| InChIKey | IUCRVYUTOSIYOP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|