C28H30N4O2S — CID 162300879
6-[1-(2-phenyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one (PubChem CID 162300879) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is 6-[1-(2-phenyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one.
| Compound Name | 6-[1-(2-phenyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 162300879 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 6-[1-(2-phenyl-1,3-thiazole-4-carbonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one |
| SMILES | O=C(CCCCCC1CCN(C(=O)c2csc(-c3ccccc3)n2)CC1)c1cc2cnccc2[nH]1 |
| InChI | InChI=1S/C28H30N4O2S/c33-26(24-17-22-18-29-14-11-23(22)30-24)10-6-1-3-7-20-12-15-32(16-13-20)28(34)25-19-35-27(31-25)21-8-4-2-5-9-21/h2,4-5,8-9,11,14,17-20,30H,1,3,6-7,10,12-13,15-16H2 |
| InChIKey | GCAPZMCUMWVERO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|