C25H29N3O2 — CID 146900863
6-(1-benzoylpiperidin-4-yl)-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one (PubChem CID 146900863) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 6-(1-benzoylpiperidin-4-yl)-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one.
| Compound Name | 6-(1-benzoylpiperidin-4-yl)-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 146900863 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 6-(1-benzoylpiperidin-4-yl)-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one |
| SMILES | O=C(CCCCCC1CCN(C(=O)c2ccccc2)CC1)c1cc2cnccc2[nH]1 |
| InChI | InChI=1S/C25H29N3O2/c29-24(23-17-21-18-26-14-11-22(21)27-23)10-6-1-3-7-19-12-15-28(16-13-19)25(30)20-8-4-2-5-9-20/h2,4-5,8-9,11,14,17-19,27H,1,3,6-7,10,12-13,15-16H2 |
| InChIKey | PJZADLTXSQJWCT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|