C23H27FN4O3S — CID 70983957
N-[4-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]butyl]-1H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 70983957) has the molecular formula C23H27FN4O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is N-[4-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]butyl]-1H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]butyl]-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70983957 |
| Molecular Formula | C23H27FN4O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[4-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]butyl]-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(S(=O)(=O)c2ccc(F)cc2)CC1)c1cc2cnccc2[nH]1 |
| InChI | InChI=1S/C23H27FN4O3S/c24-19-4-6-20(7-5-19)32(30,31)28-13-9-17(10-14-28)3-1-2-11-26-23(29)22-15-18-16-25-12-8-21(18)27-22/h4-8,12,15-17,27H,1-3,9-11,13-14H2,(H,26,29) |
| InChIKey | ZZTRLIZCTWBDND-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|