C24H29N3O3S — CID 162300880
6-[1-(benzenesulfonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one (PubChem CID 162300880) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 6-[1-(benzenesulfonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one.
| Compound Name | 6-[1-(benzenesulfonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 162300880 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 6-[1-(benzenesulfonyl)piperidin-4-yl]-1-(1H-pyrrolo[3,2-c]pyridin-2-yl)hexan-1-one |
| SMILES | O=C(CCCCCC1CCN(S(=O)(=O)c2ccccc2)CC1)c1cc2cnccc2[nH]1 |
| InChI | InChI=1S/C24H29N3O3S/c28-24(23-17-20-18-25-14-11-22(20)26-23)10-6-1-3-7-19-12-15-27(16-13-19)31(29,30)21-8-4-2-5-9-21/h2,4-5,8-9,11,14,17-19,26H,1,3,6-7,10,12-13,15-16H2 |
| InChIKey | UFXPMTTWZADYDL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|