C17H22N2O4 — CID 69325150
4-[3-(furo[3,2-c]pyridin-2-ylmethoxy)propyl]piperidine-1-carboxylic acid (PubChem CID 69325150) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-[3-(furo[3,2-c]pyridin-2-ylmethoxy)propyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[3-(furo[3,2-c]pyridin-2-ylmethoxy)propyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69325150 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-[3-(furo[3,2-c]pyridin-2-ylmethoxy)propyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(CCCOCc2cc3cnccc3o2)CC1 |
| InChI | InChI=1S/C17H22N2O4/c20-17(21)19-7-4-13(5-8-19)2-1-9-22-12-15-10-14-11-18-6-3-16(14)23-15/h3,6,10-11,13H,1-2,4-5,7-9,12H2,(H,20,21) |
| InChIKey | GPTLXALAIVQNCO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|