C8H6N2S — CID 137209130
2,6-naphthyridine-4-thiol (PubChem CID 137209130) has the molecular formula C8H6N2S and a molecular weight of 162.22 g/mol. Its IUPAC name is 2,6-naphthyridine-4-thiol.
| Compound Name | 2,6-naphthyridine-4-thiol |
|---|---|
| PubChem CID | 137209130 |
| Molecular Formula | C8H6N2S |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 2,6-naphthyridine-4-thiol |
| SMILES | Sc1cncc2ccncc12 |
| InChI | InChI=1S/C8H6N2S/c11-8-5-10-3-6-1-2-9-4-7(6)8/h1-5,11H |
| InChIKey | VKBUEFZGKBKQGF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|