C11H7N3 — CID 118895264
pyrido[4,3-h]quinazoline (PubChem CID 118895264) has the molecular formula C11H7N3 and a molecular weight of 181.20 g/mol. Its IUPAC name is pyrido[4,3-h]quinazoline.
| Compound Name | pyrido[4,3-h]quinazoline |
|---|---|
| PubChem CID | 118895264 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | pyrido[4,3-h]quinazoline |
| SMILES | c1cc2ccc3cncnc3c2cn1 |
| InChI | InChI=1S/C11H7N3/c1-2-9-5-13-7-14-11(9)10-6-12-4-3-8(1)10/h1-7H |
| InChIKey | MXJCFCGHVYSEBF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|