About 7,8-diiodoquinazoline
7,8-diiodoquinazoline (PubChem CID 174195964) has the molecular formula C8H4I2N2
and a molecular weight of 381.94 g/mol. Its IUPAC name is 7,8-diiodoquinazoline.
Molecular Properties
| Compound Name | 7,8-diiodoquinazoline |
| PubChem CID | 174195964 |
| Molecular Formula | C8H4I2N2 |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.85 |
| IUPAC Name | 7,8-diiodoquinazoline |
| SMILES | Ic1ccc2cncnc2c1I |
| InChI | InChI=1S/C8H4I2N2/c9-6-2-1-5-3-11-4-12-8(5)7(6)10/h1-4H |
| InChIKey | VXEQBIQMMLFTOD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7,8-diiodoquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diiodoquinazoline?
The IUPAC name of 7,8-diiodoquinazoline (CID 174195964) is 7,8-diiodoquinazoline.
What is the SMILES notation for 7,8-diiodoquinazoline?
The canonical SMILES for 7,8-diiodoquinazoline is Ic1ccc2cncnc2c1I.
What is the InChIKey of 7,8-diiodoquinazoline?
The InChIKey is VXEQBIQMMLFTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4I2N2/c9-6-2-1-5-3-11-4-12-8(5)7(6)10/h1-4H.
What are the key properties of 7,8-diiodoquinazoline?
7,8-diiodoquinazoline has a molecular weight of 381.94 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diiodoquinazoline is sourced from PubChem (CID 174195964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).