C7H5NO2 — CID 147216900
furo[2,3-c]pyridin-2-ol (PubChem CID 147216900) has the molecular formula C7H5NO2 and a molecular weight of 135.12 g/mol. Its IUPAC name is furo[2,3-c]pyridin-2-ol.
| Compound Name | furo[2,3-c]pyridin-2-ol |
|---|---|
| PubChem CID | 147216900 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | furo[2,3-c]pyridin-2-ol |
| SMILES | Oc1cc2ccncc2o1 |
| InChI | InChI=1S/C7H5NO2/c9-7-3-5-1-2-8-4-6(5)10-7/h1-4,9H |
| InChIKey | CGHKBFNCZGAHGF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |