About furo[3,2-e][1]benzofuran-2,7-diol
furo[3,2-e][1]benzofuran-2,7-diol (PubChem CID 69037030) has the molecular formula C10H6O4
and a molecular weight of 190.15 g/mol. Its IUPAC name is furo[3,2-e][1]benzofuran-2,7-diol.
Molecular Properties
| Compound Name | furo[3,2-e][1]benzofuran-2,7-diol |
| PubChem CID | 69037030 |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | furo[3,2-e][1]benzofuran-2,7-diol |
| SMILES | Oc1cc2c(ccc3oc(O)cc32)o1 |
| InChI | InChI=1S/C10H6O4/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h1-4,11-12H |
| InChIKey | XVZCODVIMRZMOW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furo[3,2-e][1]benzofuran-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-e][1]benzofuran-2,7-diol?
The IUPAC name of furo[3,2-e][1]benzofuran-2,7-diol (CID 69037030) is furo[3,2-e][1]benzofuran-2,7-diol.
What is the SMILES notation for furo[3,2-e][1]benzofuran-2,7-diol?
The canonical SMILES for furo[3,2-e][1]benzofuran-2,7-diol is Oc1cc2c(ccc3oc(O)cc32)o1.
What is the InChIKey of furo[3,2-e][1]benzofuran-2,7-diol?
The InChIKey is XVZCODVIMRZMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O4/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h1-4,11-12H.
What are the key properties of furo[3,2-e][1]benzofuran-2,7-diol?
furo[3,2-e][1]benzofuran-2,7-diol has a molecular weight of 190.15 g/mol, XLogP of 2.59, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-e][1]benzofuran-2,7-diol is sourced from PubChem (CID 69037030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).