C10H8N2O2 — CID 69040875
2-amino-6H-furo[3,2-e]indol-7-ol (PubChem CID 69040875) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-amino-6H-furo[3,2-e]indol-7-ol.
| Compound Name | 2-amino-6H-furo[3,2-e]indol-7-ol |
|---|---|
| PubChem CID | 69040875 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-amino-6H-furo[3,2-e]indol-7-ol |
| SMILES | Nc1cc2c(ccc3[nH]c(O)cc32)o1 |
| InChI | InChI=1S/C10H8N2O2/c11-9-3-6-5-4-10(13)12-7(5)1-2-8(6)14-9/h1-4,12-13H,11H2 |
| InChIKey | UCUROVRIPCTJPH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |