About 4-iodo-1H-indol-2-ol
4-iodo-1H-indol-2-ol (PubChem CID 53412876) has the molecular formula C8H6INO
and a molecular weight of 259.05 g/mol. Its IUPAC name is 4-iodo-1H-indol-2-ol.
Molecular Properties
| Compound Name | 4-iodo-1H-indol-2-ol |
| PubChem CID | 53412876 |
| Molecular Formula | C8H6INO |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 4-iodo-1H-indol-2-ol |
| SMILES | Oc1cc2c(I)cccc2[nH]1 |
| InChI | InChI=1S/C8H6INO/c9-6-2-1-3-7-5(6)4-8(11)10-7/h1-4,10-11H |
| InChIKey | GGNRGJWBHDQNBT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1H-indol-2-ol?
The IUPAC name of 4-iodo-1H-indol-2-ol (CID 53412876) is 4-iodo-1H-indol-2-ol.
What is the SMILES notation for 4-iodo-1H-indol-2-ol?
The canonical SMILES for 4-iodo-1H-indol-2-ol is Oc1cc2c(I)cccc2[nH]1.
What is the InChIKey of 4-iodo-1H-indol-2-ol?
The InChIKey is GGNRGJWBHDQNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6INO/c9-6-2-1-3-7-5(6)4-8(11)10-7/h1-4,10-11H.
What are the key properties of 4-iodo-1H-indol-2-ol?
4-iodo-1H-indol-2-ol has a molecular weight of 259.05 g/mol, XLogP of 2.48, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1H-indol-2-ol is sourced from PubChem (CID 53412876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).