C8H9N3O — CID 159349457
5,6-diamino-1H-indol-2-ol (PubChem CID 159349457) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 5,6-diamino-1H-indol-2-ol.
| Compound Name | 5,6-diamino-1H-indol-2-ol |
|---|---|
| PubChem CID | 159349457 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5,6-diamino-1H-indol-2-ol |
| SMILES | Nc1cc2cc(O)[nH]c2cc1N |
| InChI | InChI=1S/C8H9N3O/c9-5-1-4-2-8(12)11-7(4)3-6(5)10/h1-3,11-12H,9-10H2 |
| InChIKey | LHDISNMFJQXZLM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|