C38H50FN5O4 — CID 142065841
(2R)-2-benzyl-5-[4-(2-furo[3,2-c]pyridin-2-ylpropan-2-yl)piperazin-1-yl]-4-hydroxypentanamide;2,3-dihydro-1H-indene;N-(2-fluoroethyl)formamide (PubChem CID 142065841) has the molecular formula C38H50FN5O4 and a molecular weight of 659.85 g/mol. Its IUPAC name is (2R)-2-benzyl-5-[4-(2-furo[3,2-c]pyridin-2-ylpropan-2-yl)piperazin-1-yl]-4-hydroxypentanamide;2,3-dihydro-1H-indene;N-(2-fluoroethyl)formamide.
| Compound Name | (2R)-2-benzyl-5-[4-(2-furo[3,2-c]pyridin-2-ylpropan-2-yl)piperazin-1-yl]-4-hydroxypentanamide;2,3-dihydro-1H-indene;N-(2-fluoroethyl)formamide |
|---|---|
| PubChem CID | 142065841 |
| Molecular Formula | C38H50FN5O4 |
| Molecular Weight | 659.85 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | (2R)-2-benzyl-5-[4-(2-furo[3,2-c]pyridin-2-ylpropan-2-yl)piperazin-1-yl]-4-hydroxypentanamide;2,3-dihydro-1H-indene;N-(2-fluoroethyl)formamide |
| SMILES | CC(C)(c1cc2cnccc2o1)N1CCN(CC(O)C[C@@H](Cc2ccccc2)C(N)=O)CC1.O=CNCCF.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C26H34N4O3.C9H10.C3H6FNO/c1-26(2,24-16-21-17-28-9-8-23(21)33-24)30-12-10-29(11-13-30)18-22(31)15-20(25(27)32)14-19-6-4-3-5-7-19;1-2-5-9-7-3-6-8(9)4-1;4-1-2-5-3-6/h3-9,16-17,20,22,31H,10-15,18H2,1-2H3,(H2,27,32);1-2,4-5H,3,6-7H2;3H,1-2H2,(H,5,6)/t20-,22?;;/m1../s1 |
| InChIKey | XEYRDEDEUCZYMU-QRKFFEHMSA-N |
| XLogP | 4.65 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|