C24H39N3O5 — CID 142065820
tert-butyl 4-[(2S,4R)-4-benzyl-2-hydroxy-5-(2-hydroxypropan-2-ylamino)-5-oxopentyl]piperazine-1-carboxylate (PubChem CID 142065820) has the molecular formula C24H39N3O5 and a molecular weight of 449.59 g/mol. Its IUPAC name is tert-butyl 4-[(2S,4R)-4-benzyl-2-hydroxy-5-(2-hydroxypropan-2-ylamino)-5-oxopentyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S,4R)-4-benzyl-2-hydroxy-5-(2-hydroxypropan-2-ylamino)-5-oxopentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142065820 |
| Molecular Formula | C24H39N3O5 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | tert-butyl 4-[(2S,4R)-4-benzyl-2-hydroxy-5-(2-hydroxypropan-2-ylamino)-5-oxopentyl]piperazine-1-carboxylate |
| SMILES | CC(C)(O)NC(=O)[C@H](Cc1ccccc1)C[C@H](O)CN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H39N3O5/c1-23(2,3)32-22(30)27-13-11-26(12-14-27)17-20(28)16-19(21(29)25-24(4,5)31)15-18-9-7-6-8-10-18/h6-10,19-20,28,31H,11-17H2,1-5H3,(H,25,29)/t19-,20+/m1/s1 |
| InChIKey | AMGLHJKEWBHXST-UXHICEINSA-N |
| XLogP | 1.99 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|