C22H31N3O3 — CID 57185615
tert-butyl 4-[2-hydroxy-3-(naphthalen-2-ylamino)propyl]piperazine-1-carboxylate (PubChem CID 57185615) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl 4-[2-hydroxy-3-(naphthalen-2-ylamino)propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-hydroxy-3-(naphthalen-2-ylamino)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57185615 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl 4-[2-hydroxy-3-(naphthalen-2-ylamino)propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(O)CNc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C22H31N3O3/c1-22(2,3)28-21(27)25-12-10-24(11-13-25)16-20(26)15-23-19-9-8-17-6-4-5-7-18(17)14-19/h4-9,14,20,23,26H,10-13,15-16H2,1-3H3 |
| InChIKey | ARYRADKYTQQOLY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |