C16H25N3O3 — CID 82045302
tert-butyl 4-(2-hydroxy-2-pyridin-2-ylethyl)piperazine-1-carboxylate (PubChem CID 82045302) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl 4-(2-hydroxy-2-pyridin-2-ylethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-hydroxy-2-pyridin-2-ylethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 82045302 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl 4-(2-hydroxy-2-pyridin-2-ylethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(O)c2ccccn2)CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)22-15(21)19-10-8-18(9-11-19)12-14(20)13-6-4-5-7-17-13/h4-7,14,20H,8-12H2,1-3H3 |
| InChIKey | REOGZPRCJOEGAI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |