C24H33NO4 — CID 18948430
tert-butyl 4-hydroxy-5-morpholin-4-yl-2-(naphthalen-1-ylmethyl)pentanoate (PubChem CID 18948430) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-5-morpholin-4-yl-2-(naphthalen-1-ylmethyl)pentanoate.
| Compound Name | tert-butyl 4-hydroxy-5-morpholin-4-yl-2-(naphthalen-1-ylmethyl)pentanoate |
|---|---|
| PubChem CID | 18948430 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | tert-butyl 4-hydroxy-5-morpholin-4-yl-2-(naphthalen-1-ylmethyl)pentanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1cccc2ccccc12)CC(O)CN1CCOCC1 |
| InChI | InChI=1S/C24H33NO4/c1-24(2,3)29-23(27)20(16-21(26)17-25-11-13-28-14-12-25)15-19-9-6-8-18-7-4-5-10-22(18)19/h4-10,20-21,26H,11-17H2,1-3H3 |
| InChIKey | ZOTWNHFPZAAJNV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |