C18H22F3N3O2 — CID 142065736
1-[(5-phenylfuran-2-yl)methyl]piperazine;N-(2,2,2-trifluoroethyl)formamide (PubChem CID 142065736) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-[(5-phenylfuran-2-yl)methyl]piperazine;N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | 1-[(5-phenylfuran-2-yl)methyl]piperazine;N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 142065736 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[(5-phenylfuran-2-yl)methyl]piperazine;N-(2,2,2-trifluoroethyl)formamide |
| SMILES | O=CNCC(F)(F)F.c1ccc(-c2ccc(CN3CCNCC3)o2)cc1 |
| InChI | InChI=1S/C15H18N2O.C3H4F3NO/c1-2-4-13(5-3-1)15-7-6-14(18-15)12-17-10-8-16-9-11-17;4-3(5,6)1-7-2-8/h1-7,16H,8-12H2;2H,1H2,(H,7,8) |
| InChIKey | NYEKIHDUOKNIDC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|