C22H35F2NO2 — CID 11689508
4,4-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-methyltridecan-5-one (PubChem CID 11689508) has the molecular formula C22H35F2NO2 and a molecular weight of 383.52 g/mol. Its IUPAC name is 4,4-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-methyltridecan-5-one.
| Compound Name | 4,4-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-methyltridecan-5-one |
|---|---|
| PubChem CID | 11689508 |
| Molecular Formula | C22H35F2NO2 |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 4,4-difluoro-3-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-methyltridecan-5-one |
| SMILES | CCCCCCCCC(=O)C(F)(F)C(N[C@@H](CO)c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H35F2NO2/c1-4-5-6-7-8-12-15-20(27)22(23,24)21(17(2)3)25-19(16-26)18-13-10-9-11-14-18/h9-11,13-14,17,19,21,25-26H,4-8,12,15-16H2,1-3H3/t19-,21?/m0/s1 |
| InChIKey | YRVYLXCRBKPBCZ-ZQRQZVKFSA-N |
| XLogP | 5.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|