C20H17FN2O3S — CID 11689522
5-N-[1-[3-(3-fluorophenyl)phenyl]ethyl]-2-N-hydroxythiophene-2,5-dicarboxamide (PubChem CID 11689522) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is 5-N-[1-[3-(3-fluorophenyl)phenyl]ethyl]-2-N-hydroxythiophene-2,5-dicarboxamide.
| Compound Name | 5-N-[1-[3-(3-fluorophenyl)phenyl]ethyl]-2-N-hydroxythiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 11689522 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 5-N-[1-[3-(3-fluorophenyl)phenyl]ethyl]-2-N-hydroxythiophene-2,5-dicarboxamide |
| SMILES | CC(NC(=O)c1ccc(C(=O)NO)s1)c1cccc(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C20H17FN2O3S/c1-12(22-19(24)17-8-9-18(27-17)20(25)23-26)13-4-2-5-14(10-13)15-6-3-7-16(21)11-15/h2-12,26H,1H3,(H,22,24)(H,23,25) |
| InChIKey | OKFWRXNYYCQVNI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|