C20H18Cl2N2O2 — CID 11689628
1-[2-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]pyrrolidine-2,5-dione (PubChem CID 11689628) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 1-[2-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11689628 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1-[2-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]pyrrolidine-2,5-dione |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2[C@@H](c2ccccc2N2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-23-10-15(14-8-12(21)9-17(22)16(14)11-23)13-4-2-3-5-18(13)24-19(25)6-7-20(24)26/h2-5,8-9,15H,6-7,10-11H2,1H3/t15-/m1/s1 |
| InChIKey | CSDVHARTMOCYDL-OAHLLOKOSA-N |
| XLogP | 4.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|