About 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride
2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride (PubChem CID 89088125) has the molecular formula C16H14Cl3NO2S
and a molecular weight of 390.72 g/mol. Its IUPAC name is 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride |
| PubChem CID | 89088125 |
| Molecular Formula | C16H14Cl3NO2S |
| Molecular Weight | 390.72 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccccc2S(=O)(=O)Cl)C1 |
| InChI | InChI=1S/C16H14Cl3NO2S/c1-20-8-13(11-4-2-3-5-16(11)23(19,21)22)12-6-10(17)7-15(18)14(12)9-20/h2-7,13H,8-9H2,1H3 |
| InChIKey | KILALHNNOCSBQS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.72 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride?
The IUPAC name of 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride (CID 89088125) is 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride.
What is the SMILES notation for 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride?
The canonical SMILES for 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride is CN1Cc2c(Cl)cc(Cl)cc2C(c2ccccc2S(=O)(=O)Cl)C1.
What is the InChIKey of 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride?
The InChIKey is KILALHNNOCSBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl3NO2S/c1-20-8-13(11-4-2-3-5-16(11)23(19,21)22)12-6-10(17)7-15(18)14(12)9-20/h2-7,13H,8-9H2,1H3.
What are the key properties of 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride?
2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride has a molecular weight of 390.72 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride is sourced from PubChem (CID 89088125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).