C20H22FNO4S — CID 11689682
tert-butyl 3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 11689682) has the molecular formula C20H22FNO4S and a molecular weight of 391.46 g/mol. Its IUPAC name is tert-butyl 3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | tert-butyl 3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11689682 |
| Molecular Formula | C20H22FNO4S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tert-butyl 3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C(=O)OC(C)(C)C)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H22FNO4S/c1-13-5-11-16(12-6-13)27(24,25)22-17(14-7-9-15(21)10-8-14)18(22)19(23)26-20(2,3)4/h5-12,17-18H,1-4H3 |
| InChIKey | LRLRNXLYCDAWQJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|