C18H16F3NO3S — CID 100991714
methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate (PubChem CID 100991714) has the molecular formula C18H16F3NO3S and a molecular weight of 383.39 g/mol. Its IUPAC name is methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate.
| Compound Name | methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 100991714 |
| Molecular Formula | C18H16F3NO3S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | methyl (2S,3S)-1-(4-methylphenyl)sulfinyl-3-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2ccc(C(F)(F)F)cc2)N1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H16F3NO3S/c1-11-3-9-14(10-4-11)26(24)22-15(16(22)17(23)25-2)12-5-7-13(8-6-12)18(19,20)21/h3-10,15-16H,1-2H3/t15-,16-,22?,26?/m0/s1 |
| InChIKey | YPTXPYIVIFWNQK-IVCCASICSA-N |
| XLogP | 3.63 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|