C22H22F3NO6S — CID 138967364
diethyl 1-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]aziridine-2,2-dicarboxylate (PubChem CID 138967364) has the molecular formula C22H22F3NO6S and a molecular weight of 485.48 g/mol. Its IUPAC name is diethyl 1-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]aziridine-2,2-dicarboxylate.
| Compound Name | diethyl 1-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]aziridine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 138967364 |
| Molecular Formula | C22H22F3NO6S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | diethyl 1-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]aziridine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(c2ccc(C(F)(F)F)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H22F3NO6S/c1-4-31-19(27)21(20(28)32-5-2)18(15-8-10-16(11-9-15)22(23,24)25)26(21)33(29,30)17-12-6-14(3)7-13-17/h6-13,18H,4-5H2,1-3H3 |
| InChIKey | ARUYLOQHOGZYRU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|